Discover the exceptional N~1~,N~1~-Diethyl-1-phenylethane-1,2-diamine dihydrochloride, a high-purity (Min. 95%) amine compound with a diverse range of applications. This versatile chemical, bearing the CAS number 31788-97-3, boasts a molecular weight of 192.3 g/mol and a unique molecular structure that unlocks a world of possibilities in your research and development endeavors. Harness the power of this premium-quality compound to elevate your experiments, leveraging its exceptional reactivity and selectivity. However, exercise caution as it may cause skin and eye irritation, and respiratory discomfort. Ensure proper handling and storage in a cool, well-ventilated area to maximize its performance and safety.
Unlock the versatile potential of N~1~,N~1~-Diethyl-1-phenylethane-1,2-diamine dihydrochloride, a highly specialized chemical compound that holds immense value for researchers and scientists across various disciplines. This Amine-based compound, identified by its CAS number 31788-97-3, boasts a unique molecular structure that enables a wide range of applications, from pharmaceutical development to material science innovations.
At the heart of this compound lies a captivating blend of chemical properties, making it a sought-after asset in the world of scientific exploration. With a molecular formula of C12H20N2 and a molecular weight of 192.3 g/mol, N~1~,N~1~-Diethyl-1-phenylethane-1,2-diamine dihydrochloride presents itself as a crystalline solid, offering a purity of at least 95% to ensure reliable and consistent results in your research endeavors.
In the realm of pharmaceutical research, this compound shines as a versatile building block, enabling the synthesis of innovative drug candidates. Its unique structural features and chemical reactivity make it a valuable tool in the development of targeted therapies, addressing a wide spectrum of health conditions. Researchers can leverage the compound's properties to explore new avenues in drug discovery, potentially leading to breakthroughs that improve patient outcomes and quality of life.
Beyond the pharmaceutical realm, N~1~,N~1~-Diethyl-1-phenylethane-1,2-diamine dihydrochloride finds applications in the field of agrochemicals. Its distinct molecular structure contributes to the formulation of advanced crop protection agents, helping to safeguard crops and enhance agricultural productivity while minimizing environmental impact.
In the dynamic world of material science, this compound emerges as a valuable asset, unlocking new possibilities in the development of innovative materials. Researchers can harness the compound's chemical properties to engineer substances with tailored characteristics, such as improved thermal stability, mechanical strength, or optical performance. These advancements can lead to the creation of cutting-edge materials with diverse applications, from high-tech electronics to advanced composites.
Alongside its versatile applications, N~1~,N~1~-Diethyl-1-phenylethane-1,2-diamine dihydrochloride is meticulously crafted to meet the highest standards of quality and purity. Its INCHI code, InChI=1S/C12H20N2/c1-3-14(4-2)12(10-13)11-8-6-5-7-9-11/h5-9,12H,3-4,10,13H2,1-2H3, and SMILES notation, CCN(CC)C(CN)c1ccccc1, provide a unique identifier for researchers seeking detailed information about this compound.
To maintain the integrity and stability of N~1~,N~1~-Diethyl-1-phenylethane-1,2-diamine dihydrochloride, it is essential to adhere to proper handling and storage protocols. The compound should be stored in a cool, well-ventilated area, protected from moisture and other environmental factors that could compromise its purity and performance. By following these guidelines, researchers can ensure the long-term viability of this valuable chemical asset, unlocking its full potential in their scientific endeavors.
Embark on your journey of discovery with N~1~,N~1~-Diethyl-1-phenylethane-1,2-diamine dihydrochloride, a compound that holds the key to unlocking new frontiers in pharmaceutical research, agrochemical development, and material science innovations. Leverage its unique properties and purity to drive your research forward, pushing the boundaries of what is possible in the