Discover the exceptional NERVONIC ACID METHYL ESTER, a high-purity analytical standard (≥99.0% GC) that unlocks a world of possibilities in your chemical research. With its unique molecular formula of C25H48O2 and a molecular weight of 380.6474g/mol, this compound offers unparalleled precision and reliability. Boasting an InChI key of AINIZSBLAFHZCP-KHPPLWFESA-N, this versatile fatty acid ester is a valuable asset for a wide range of applications, from pharmaceuticals to cosmetics. However, handle with care as it may cause skin, eye, and respiratory irritation. Ensure proper storage in a cool, well-ventilated area and follow safety guidelines to maximize its potential in your laboratory.
Embrace the power of NERVONIC ACID METHYL ESTER and elevate your research to new heights.
Nervonic Acid Methyl Ester, with the CAS number 2733-88-2, is a highly purified and versatile chemical compound that holds immense value in the realm of scientific research and development. This Fatty Acid derivative, known for its distinct properties, is a crucial asset in a wide range of applications, from pharmaceutical advancements to material science innovations.
This compound, with the molecular formula C25H48O2, presents itself as a clear, pale liquid with a molecular weight of 380.6474 g/mol. Its exceptional purity, exceeding 99.0% as determined by GC analysis, ensures reliable and consistent results in experimental settings. The compound's unique InChI code, InChI=1S/C25H48O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(26)27-2/h10-11H,3-9,12-24H2,1-2H3/b11-10-, and MDL number, MFCD00056324, provide a distinct identifier for researchers seeking specific information.
Nervonic Acid Methyl Ester's versatility and exceptional properties make it a valuable asset in various scientific domains:
Pharmaceutical Research: This compound serves as a crucial building block in the synthesis of pharmaceutical compounds. Its unique chemical structure allows for the development of innovative drugs targeting a wide range of health conditions, from neurological disorders to metabolic diseases.
Agrochemical Innovation: In the agrochemical sector, Nervonic Acid Methyl Ester contributes to the creation of advanced crop protection agents. Its distinct molecular structure enables the formulation of potent and selective pesticides, promoting healthier crops and higher yields.
Material Science: Researchers in material science utilize this compound to explore new materials with enhanced performance characteristics, such as improved mechanical strength, thermal stability, or optical properties. Its integration into polymers or coatings can lead to the development of innovative materials with tailored functionalities.
To delve deeper into the technical details, applications, and safety guidelines of Nervonic Acid Methyl Ester, consult relevant scientific literature, technical documents, and other resources. These materials can provide a comprehensive understanding of the compound's potential and support your research endeavors.