Discover the captivating 5-Methylbenzene-1,3-diol Hydrate, a remarkable biochemical compound that holds the key to unlocking new possibilities in your research and applications. This hydrated form, with the CAS number 6153-39-5, boasts a molecular weight of 142.14 + 18.02 g/mol, offering a unique blend of chemical properties that make it a valuable asset in the world of organic synthesis and functional enhancements. Derived from lichen fungi, this compound has been found to improve the functional properties of lysozyme, a versatile enzyme with a wide range of applications. Embrace the power of this exceptional biochemical and let it elevate your work to new heights of innovation and success.
Unlock the versatile potential of 5-Methylbenzene-1,3-diol Hydrate, a captivating chemical compound that holds the key to unlocking new frontiers in scientific research and development. This hydrated form of 3,5-Dihydroxytoluene, identified by the CAS number 6153-39-5, boasts a unique molecular structure that has captured the attention of researchers across diverse fields.
At the heart of this compound lies a captivating blend of chemical properties, making it a valuable asset in a wide range of applications. From its potential to enhance the functional properties of lysozyme, a crucial enzyme in the human body, to its intriguing presence in lichen fungi, 5-Methylbenzene-1,3-diol Hydrate is a veritable treasure trove of possibilities.
Delve into the intricate world of this compound, and you'll uncover a wealth of opportunities waiting to be explored. Its InChI code, InChI=1S/C7H8O2.H2O/c1-5-2-6(8)4-7(9)3-5;/h2-4,8-9H,1H3;1H2, and SMILES notation, Cc1cc(O)cc(O)c1.O, provide a unique identifier that allows researchers to navigate the complex landscape of chemical compounds with precision.
As a Biochemical and Reagent, 5-Methylbenzene-1,3-diol Hydrate finds its niche within the Organic Building Blocks subcategory. Its versatility extends beyond the confines of a single application, making it a valuable tool in the hands of scientists and researchers seeking to push the boundaries of their respective fields.
Unlock the potential of this captivating compound and embark on a journey of discovery. Whether you're exploring new pharmaceutical frontiers, investigating the intricacies of lichen fungi, or delving into the world of lysozyme enhancement, 5-Methylbenzene-1,3-diol Hydrate stands ready to be your trusted companion, guiding you towards groundbreaking advancements.
To delve deeper into