(4-isopropoxyphenyl)methanamine hydrochloride

Unlock the versatile potential of (4-isopropoxyphenyl)methanamine hydrochloride, a highly specialized organic compound that holds immense value for researchers and scientists across diverse fields. With its unique chemical structure and exceptional purity, this compound stands as a crucial building block in the pursuit of groundbreaking discoveries and innovations.

Unraveling the Compound's Essence

Identified by its CAS number 100131-60-0, (4-isopropoxyphenyl)methanamine hydrochloride is a meticulously crafted organic halide that boasts a purity of 97%. Its molecular formula, C10H16ClNO, and a molecular weight of 201.6931 g/mol, endow it with distinct properties that make it a valuable asset in various scientific endeavors.

The compound's INCHI code, InChI=1S/C10H15NO.ClH/c1-8(2)12-10-5-3-9(7-11)4-6-10;/h3-6,8H,7,11H2,1-2H3;1H, and its INCHI key, SPJGJFSVQLJRFY-UHFFFAOYSA-N, provide a unique identifier that allows researchers to easily access and cross-reference relevant information about this versatile chemical.

Unlocking the Potential

The versatility of (4-isopropoxyphenyl)methanamine hydrochloride lies in its diverse applications across various scientific disciplines. Its unique chemical properties and structure make it a valuable asset in the following areas:

Pharmaceutical Research

In the realm of pharmaceutical research, this compound serves as a crucial building block in the synthesis of innovative drug candidates. Its distinct molecular architecture allows for the development of targeted therapies that address a wide range of health conditions, from neurological disorders to metabolic diseases. Researchers can leverage the compound's properties to create novel pharmaceutical compounds with enhanced efficacy and improved pharmacological profiles.

Agrochemical Development

The agricultural industry also benefits from the versatility of (4-isopropoxyphenyl)methanamine hydrochloride. This compound is employed as a key ingredient in the synthesis of advanced crop protection agents, such as potent and selective pesticides. By incorporating the compound's unique structural features, researchers can formulate agrochemicals that promote healthier crops, higher yields, and a more sustainable approach to agricultural practices.

Chemical Synthesis

Beyond the realms of pharmaceuticals and agrochemicals, (4-isopropoxyphenyl)methanamine hydrochloride finds its place as a valuable tool in the broader field of chemical synthesis. Its distinct chemical properties and reactivity make it a sought-after reagent for the creation of novel compounds with tailored characteristics. Researchers in material science, organic chemistry, and other related disciplines can leverage this compound to unlock new possibilities in their respective areas of study.

Handling and Storage

While (4-isopropoxyphenyl)methanamine hydrochloride is a highly versatile compound, it is essential to handle it with care and adhere to appropriate safety protocols. The compound is classified as harmful if swallowed, causing skin irritation, serious eye irritation, and potential respiratory irritation. Proper personal protective equipment, such as gloves, protective clothing, eye protection, and face masks, should be used when working with this compound.

For optimal storage and to maintain the compound's purity and stability, it is recommended to keep (4-isopropoxyphenyl)methanamine hydrochloride in a cool, well-ventilated area, away from direct light and moisture. Following these guidelines will ensure the compound's long-term viability and reliability in your research endeavors.

Unlocking the Possibilities

As you embark on your scientific journey, let (4-isopropoxyphenyl)methanamine hydrochloride be your trusted companion. Explore its vast