2-(7-Fluoro-4-methyl-5-oxo-2,3,4,5,-tetrahydro-1H-1,4-benzodiazepine-2-ylidene)glycine Ethyl Ester Hydrochloride

Unlock the versatile potential of 2-(7-Fluoro-4-methyl-5-oxo-2,3,4,5,-tetrahydro-1H-1,4-benzodiazepine-2-ylidene)glycine Ethyl Ester Hydrochloride, a highly specialized chemical compound that holds immense value for researchers and scientists across various fields. This Fluorinated Compound, with its unique molecular structure and exceptional purity, is a crucial asset in the pursuit of groundbreaking discoveries and advancements.

Boasting a CAS number of 'Not Available' and a molecular formula of C14H16FN3O3·ClH, this compound presents a molecular weight of 329.7545 g/mol. Its INCHI code, /h4-6,17H,3,7,16H2,1-2H3, InChI=1S/C14H16FN3O3.ClH/c1-3-21-14(20)12(16)11-7-18(2)13(19)9-6-8(15)4-5-10(9)17-11, 1H/b12-11-, provides a unique identifier for researchers seeking detailed information.

The versatility of 2-(7-Fluoro-4-methyl-5-oxo-2,3,4,5,-tetrahydro-1H-1,4-benzodiazepine-2-ylidene)glycine Ethyl Ester Hydrochloride lies in its broad range of applications, making it a valuable asset in various scientific domains.

Pharmaceutical Research

In the realm of pharmaceutical research, this compound serves as a crucial building block in the synthesis of innovative drug candidates. Its distinct chemical structure and properties allow researchers to explore the development of targeted therapies, addressing a wide spectrum of health conditions and disorders. The incorporation of the fluorine and benzodiazepine moieties within the molecule opens up new avenues for the creation of novel pharmaceutical compounds with enhanced pharmacological profiles and therapeutic potential.

Researchers in this field can leverage the unique characteristics of 2-(7-Fluoro-4-methyl-5-oxo-2,3,4,5,-tetrahydro-1H-1,4-benzodiazepine-2-ylidene)glycine Ethyl Ester Hydrochloride to design and synthesize drug candidates with improved efficacy, selectivity, and safety. The compound's versatility enables the exploration of diverse therapeutic applications, from neurological disorders to metabolic diseases, ultimately contributing to the advancement of modern medicine.

Agrochemical Development

The chemical prowess of 2-(7-Fluoro-4-methyl-5-oxo-2,3,4,5,-tetrahydro-1H-1,4-benzodiazepine-2-ylidene)glycine Ethyl Ester Hydrochloride also extends to the agrochemical industry. Researchers in this field leverage the compound's unique structural features to develop advanced crop protection agents, such as potent and selective pesticides.

The incorporation of the fluorine atom and the benzodiazepine moiety within the molecule can enhance the efficacy and specificity of these agrochemical compounds, leading to more effective and environmentally-friendly solutions for crop management. By harnessing the potential of 2-(7-Fluoro-4-methyl-5-oxo-2,3,4,5,-tetrahydro-1H-1,4-benzodiazepine-2-ylidene)glycine Ethyl Ester Hydrochloride, researchers can contribute to the development of innovative agrochemicals that promote healthier crops, higher yields, and a more sustainable agricultural landscape.

Chemical Synthesis

Beyond its